ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
818-04-2 diisopentyl succinate |
|
| Nama produk | diisopentyl succinate |
| Nama bahasa Inggris | diisopentyl succinate;Diisopentyl succinate;AI3-01975;Di(2-methylbutyl) succinate;Butanedioic acid, bis(3-methylbutyl) ester;bis(3-methylbutyl) butanedioate |
| MF | C14H26O4 |
| Berat Molekul | 258.3538 |
| InChI | InChI=1/C14H26O4/c1-11(2)7-9-17-13(15)5-6-14(16)18-10-8-12(3)4/h11-12H,5-10H2,1-4H3 |
| CAS NO | 818-04-2 |
| EINECS | 212-448-6 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.966g/cm3 |
| Titik didih | 281.1°C at 760 mmHg |
| Indeks bias | 1.439 |
| Titik nyala | 122.6°C |
| Tekanan uap | 0.00364mmHg at 25°C |
| MSDS | |