ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-16-2 Hexoestrol |
|
| Nama produk | Hexoestrol |
| Nama bahasa Inggris | Hexoestrol;3,4-Bis(p-hydroxyphenyl)hexane;4,4'-(1,2-Diethylethylene)diphenol;Dihydrodiethylstilbestrol;MESO-HEXESTROL;(R*,S*)-4,4'-(1,2-diethylethylene)bis(phenol) |
| MF | C18H22O2 |
| Berat Molekul | 270.37 |
| InChI | InChI=1/C18H22O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,17-20H,3-4H2,1-2H3 |
| CAS NO | 84-16-2 |
| EINECS | 201-518-1 |
| Struktur Molekul | ![]() |
| MSDS | |