ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-62-8 Diphenyl phthalate |
|
| Nama produk | Diphenyl phthalate |
| Nama bahasa Inggris | Diphenyl phthalate;1,2-Benzenedicarboxylic acid, 1,2-diphenyl ester;4-09-00-03217 (Beilstein Handbook Reference);AI3-00131;BRN 2473390;Caswell No. 399B;EPA Pesticide Chemical Code 017001;NSC 4052;Phenyl phthalate;1,2-Benzenedicarboxylic acid, diphenyl ester;Phthalic acid, diphenyl ester |
| MF | C20H14O4 |
| Berat Molekul | 318.3282 |
| InChI | InChI=1/C20H14O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h1-14H |
| CAS NO | 84-62-8 |
| EINECS | 201-546-4 |
| Struktur Molekul | ![]() |
| MSDS | |