ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-66-4 1-chloro-2-(dichloromethyl)benzene |
|
| Nama produk | 1-chloro-2-(dichloromethyl)benzene |
| Nama bahasa Inggris | 1-chloro-2-(dichloromethyl)benzene;Benzene, 1-chloro-2-(dichloromethyl)-;1-Chloro-2-(dichloromethyl)benzene |
| MF | C7H5Cl3 |
| Berat Molekul | 195.4736 |
| InChI | InChI=1/C7H5Cl3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,7H |
| CAS NO | 88-66-4 |
| EINECS | 201-849-1 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.384g/cm3 |
| Titik didih | 228.5°C at 760 mmHg |
| Indeks bias | 1.561 |
| Titik nyala | 146.6°C |
| Tekanan uap | 0.11mmHg at 25°C |
| MSDS | |