ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52709-85-0 4'-nonyl[1,1'-biphenyl]-4-carbonitrile |
|
| שם המוצר | 4'-nonyl[1,1'-biphenyl]-4-carbonitrile |
| נרדפות | (1,1'-ביפניל)-4-קרבוניטריל, 4'-נוניל-; 4-ציאנו-4'-nonylbiphenyl; 4'-נוניל(1,1'-ביפניל)-4-קרבוניטריל; 4'-nonylbiphenyl-4-carbonitrile; |
| שם אנגלי | 4'-nonyl[1,1'-biphenyl]-4-carbonitrile;(1,1'-Biphenyl)-4-carbonitrile, 4'-nonyl-;4-Cyano-4'-nonylbiphenyl;4'-Nonyl(1,1'-biphenyl)-4-carbonitrile;4'-nonylbiphenyl-4-carbonitrile |
| מולקולרית פורמולה | C22H27N |
| משקל מולקולרי | 305.4565 |
| InChl | InChI=1/C22H27N/c1-2-3-4-5-6-7-8-9-19-10-14-21(15-11-19)22-16-12-20(18-23)13-17-22/h10-17H,2-9H2,1H3 |
| מספר CAS | 52709-85-0 |
| EINECS | 258-121-1 |
| מבנה מולקולרי | ![]() |
| צפיפות | 0.99g/cm3 |
| נקודת רתיחה | 446.8°C at 760 mmHg |
| משקל סגולי | 1.55 |
| נקודת הבזק | 225.6°C |
| לחץ אדים | 3.54E-08mmHg at 25°C |
| MSDS | |