Chemindex > 55901-20-7
IL ▼
55901-20-7 5-oxo-DL-proline, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1) |
|
| שם המוצר | 5-oxo-DL-proline, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1) |
| נרדפות | DL-פרולין, 5-oxo-, compd.with 2,2',2''-nitrilotris(אתנול) (1:1); TEA-PCA; Triethanolamine-dl-2-pyrrolidone-5-carboxylate; 5-Oxoproline compd.עם triethanolamine; DL-2-פירולידון-5-חומצה קרבוקסילית, מלח טריאתנולמין; 5-Oxo-DL-פרולין, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1); פרולין, 5-oxo-, compd.עם 2,2',2''-nitrilotris (אתנול) (1: 1); 5-אוקסופרולין - 2,2',2''-nitrilotriethanol (1:1); |
| שם אנגלי | 5-oxo-DL-proline, compound with 2,2',2''-nitrilotriethanol (1:1);DL-Proline, 5-oxo-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);TEA-PCA;Triethanolamine-dl-2-pyrrolidone-5-carboxylate;5-Oxoproline compd. with triethanolamine;DL-2-Pyrrolidone-5-carboxylic acid, triethanolamine salt;5-Oxo-DL-proline, compound with 2,2',2''-nitrilotriethanol (1:1);Proline, 5-oxo-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);5-oxoproline - 2,2',2''-nitrilotriethanol (1:1) |
| מולקולרית פורמולה | C11H22N2O6 |
| משקל מולקולרי | 278.3022 |
| InChl | InChI=1/C6H15NO3.C5H7NO3/c8-4-1-7(2-5-9)3-6-10;7-4-2-1-3(6-4)5(8)9/h8-10H,1-6H2;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
| מספר CAS | 55901-20-7 |
| EINECS | 259-883-8 |
| מבנה מולקולרי |  |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 55901-20-7 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 