ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56970-11-7 4'-Chlorobiphenyl-3-amine |
|
| שם המוצר | 4'-Chlorobiphenyl-3-amine |
| שם אנגלי | 4'-Chlorobiphenyl-3-amine;[1,1'-biphenyl]-3-amine, 4'-chloro-;4'-Chloro-biphenyl-3-amine |
| מולקולרית פורמולה | C12H10ClN |
| משקל מולקולרי | 203.6675 |
| InChl | InChI=1/C12H10ClN/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10/h1-8H,14H2 |
| מספר CAS | 56970-11-7 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.205g/cm3 |
| נקודת רתיחה | 369°C at 760 mmHg |
| משקל סגולי | 1.628 |
| נקודת הבזק | 177°C |
| לחץ אדים | 1.22E-05mmHg at 25°C |
| MSDS | |