ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107638-88-0 2,4-डाइक्लोरो-एन- (2,2-डाइक्लोर ओएथिल) एथेनामाइन के साथ 2,4-डिनिट्रो-3-फेनिलपेंटेन डाइनिट्राइल |
|
उत्पाद का नाम | 2,4-डाइक्लोरो-एन- (2,2-डाइक्लोर ओएथिल) एथेनामाइन के साथ 2,4-डिनिट्रो-3-फेनिलपेंटेन डाइनिट्राइल |
समानार्थी | पेंटानेडिनिट्राइल, 2,4-डिनिट्रो-3-फिनाइल-, कॉम्प।2,2-डाइक्लोरो-एन- (2,2-डाइक्लोरोइथाइल) एथेनामाइन (1: 1) के साथ; 2,4-डाइक्लोरो-एन- (2,2-डाइक्लोरोइथाइल) एथेनामाइन के साथ 2,4-डिनिट्रो-3-फेनिलपेंटेन डाइनिट्राइल; 2,4-डिनिट्रो-3-फेनिलपेंटानिट्राइल - 2,2-डाइक्लोरो-एन- (2,2-डाइक्लोरोइथाइल) एथेनामाइन (1: 1); |
अंग्रेज | 2,4-Dinitro-3-phenylpentane dinitrile with 2,2-dichloro-N-(2,2-dichlor oethyl)ethanamine;Pentanedinitrile, 2,4-dinitro-3-phenyl-, comp. with 2,2-dichloro-N-(2,2-dichloroethyl)ethanamine (1:1);2,4-Dinitro-3-phenylpentane dinitrile with 2,2-dichloro-N-(2,2-dichloroethyl)ethanamine;2,4-dinitro-3-phenylpentanedinitrile - 2,2-dichloro-N-(2,2-dichloroethyl)ethanamine (1:1) |
आणविक फार्मूला | C15H15Cl4N5O4 |
आण्विक वजन | 471.1227 |
InChI | InChI=1/C11H8N4O4.C4H7Cl4N/c12-6-9(14(16)17)11(10(7-13)15(18)19)8-4-2-1-3-5-8;5-3(6)1-9-2-4(7)8/h1-5,9-11H;3-4,9H,1-2H2 |
कैस रजिस्टी संख्या | 107638-88-0 |
आणविक संरचना | ![]() |
उबलने का समय | 484.1°C at 760 mmHg |
फ्लैश प्वाइंट | 246.6°C |
वाष्प का दबाव | 1.59E-09mmHg at 25°C |
MSDS |