ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1206-15-1 1- (4-मेथॉक्सीफेनिल) -1-साइक्लोपेंटेन कार्बोनिट्राइल |
|
उत्पाद का नाम | 1- (4-मेथॉक्सीफेनिल) -1-साइक्लोपेंटेन कार्बोनिट्राइल |
समानार्थी | 1- (4-मेथॉक्सीफेनिल) साइक्लोपेंटेन कार्बोनिट्राइल |
अंग्रेज | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile;1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
आणविक फार्मूला | C13H15NO |
आण्विक वजन | 201.2643 |
InChI | InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
कैस रजिस्टी संख्या | 1206-15-1 |
EINECS | 214-890-5 |
आणविक संरचना | ![]() |
घनत्व | 1.07g/cm3 |
उबलने का समय | 346.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.543 |
फ्लैश प्वाइंट | 146.2°C |
वाष्प का दबाव | 5.76E-05mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |