Chemindex > 5238-27-7
IN ▼
5238-27-7 2-Methylvaleryl chloride |
|
| उत्पाद का नाम | 2-Methylvaleryl chloride |
| अंग्रेज | 2-Methylvaleryl chloride;2-Methylvaleroyl Chloride;2-Methylpentanoyl chloride;(3Z)-4-hydroxy-4-(4-methylphenyl)-2-oxo-N-1,3-thiazol-2-ylbut-3-enamide;(2S)-2-methylpentanoyl chloride;(2R)-2-methylpentanoyl chloride |
| आणविक फार्मूला | C6H11ClO |
| आण्विक वजन | 134.6039 |
| InChI | InChI=1/C6H11ClO/c1-3-4-5(2)6(7)8/h5H,3-4H2,1-2H3/t5-/m1/s1 |
| कैस रजिस्टी संख्या | 5238-27-7 |
| EINECS | 226-035-3 |
| आणविक संरचना |  |
| घनत्व | 0.986g/cm3 |
| उबलने का समय | 140.4°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.422 |
| फ्लैश प्वाइंट | 41.1°C |
| वाष्प का दबाव | 6.15mmHg at 25°C |
| खतरा प्रतीक |  C##Corrosive:; |
| खतरे के कोड | R10##Flammable.||R34##Causes burns.:; |
| सुरक्षा विवरण | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 