ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
598-88-9 1,2-dichloro-1,2-difluoroethylene |
|
उत्पाद का नाम | 1,2-dichloro-1,2-difluoroethylene |
अंग्रेज | 1,2-dichloro-1,2-difluoroethylene;1,2-Dichloro-1,2-difluoroethylene;Ethene, 1,2-dichloro-1,2-difluoro-;1,2-dichloro-1,2-difluoroethene;(Z)-1,2-dichloro-1,2-difluoroethene;(E)-1,2-dichloro-1,2-difluoroethene |
आणविक फार्मूला | C2Cl2F2 |
आण्विक वजन | 132.9242 |
InChI | InChI=1/C2Cl2F2/c3-1(5)2(4)6/b2-1+ |
कैस रजिस्टी संख्या | 598-88-9 |
EINECS | 209-956-5 |
आणविक संरचना | ![]() |
घनत्व | 1.503g/cm3 |
उबलने का समय | 22.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.392 |
वाष्प का दबाव | 821mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S9##Keep container in a well-ventilated place.:; |
MSDS |