ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
606-05-3 8-ब्रोमो-1,3-डाइमिथाइल-3,7-डायहाइड्रो-1एच-प्यूरीन-2,6-डायोन - एन- (4-मेथॉक्सीबेंज़िल) -एन', एन'-डाइमिथाइल-एन- (पाइरिडिन-2-वाईएल) ईथेन-1,2-डायमाइन (1: 1) |
|
| उत्पाद का नाम | 8-ब्रोमो-1,3-डाइमिथाइल-3,7-डायहाइड्रो-1एच-प्यूरीन-2,6-डायोन - एन- (4-मेथॉक्सीबेंज़िल) -एन', एन'-डाइमिथाइल-एन- (पाइरिडिन-2-वाईएल) ईथेन-1,2-डायमाइन (1: 1) |
| समानार्थी | 8-ब्रोमो-3,7-डायहाइड्रो-1,3-डाइमिथाइल-1एच-प्यूरीन-2,6-डायोन कॉम्प।एन के साथ - [(4-मेथॉक्सीफेनिल) मिथाइल] -एन ', एन'-डाइमिथाइल-एन -2-पाइरिडिनिल -1,2-एथेनेडायमाइन (1: 1); 8-ब्रोमोथियोफिलाइन यौगिक 2 के साथ - [[2- (डाइमिथाइलैमिनो) एथिल] (पी-मेथॉक्सीबेंज़िल) एमिनो] पाइरीडिन (1: 1); |
| अंग्रेज | 8-bromo-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - N-(4-methoxybenzyl)-N',N'-dimethyl-N-(pyridin-2-yl)ethane-1,2-diamine (1:1);8-Bromo-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione compd. with N-[(4-Methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyridinyl-1,2-ethanediamine (1:1);8-Bromotheophylline compound with 2-[[2-(Dimethylamino)ethyl](p-methoxybenzyl)amino]pyridine (1:1) |
| आणविक फार्मूला | C24H30BrN7O3 |
| आण्विक वजन | 544.4441 |
| InChI | InChI=1/C17H23N3O.C7H7BrN4O2/c1-19(2)12-13-20(17-6-4-5-11-18-17)14-15-7-9-16(21-3)10-8-15;1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h4-11H,12-14H2,1-3H3;1-2H3,(H,9,10) |
| कैस रजिस्टी संख्या | 606-05-3 |
| आणविक संरचना | ![]() |
| उबलने का समय | 423.8°C at 760 mmHg |
| फ्लैश प्वाइंट | 210.1°C |
| वाष्प का दबाव | 2.17E-07mmHg at 25°C |
| MSDS | |