ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7472-43-7 6-Benzoylhexanoic acid |
|
उत्पाद का नाम | 6-Benzoylhexanoic acid |
अंग्रेज | 6-Benzoylhexanoic acid;7-Oxo-7-phenylheptanoic acid;7-Oxo-7-phenyl-heptanoic acid;6-Benzoyl hexanoic Acid |
आणविक फार्मूला | C13H16O3 |
आण्विक वजन | 220.2643 |
InChI | InChI=1/C13H16O3/c14-12(11-7-3-1-4-8-11)9-5-2-6-10-13(15)16/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,16) |
कैस रजिस्टी संख्या | 7472-43-7 |
आणविक संरचना | ![]() |
घनत्व | 1.111g/cm3 |
उबलने का समय | 396°C at 760 mmHg |
अपवर्तक सूचकांक | 1.528 |
फ्लैश प्वाइंट | 207.4°C |
वाष्प का दबाव | 5.57E-07mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |