ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-95-0 benzestrol |
|
| उत्पाद का नाम | benzestrol |
| अंग्रेज | benzestrol;Benzestrol [INN:BAN];Benzestrol;4,4'-(1,2-Diethyl-3-methyltrimethylene)diphenol;AI3-23191;Benzestrolo;Benzestrolo [DCIT];Benzestrolum;Benzestrolum [INN-Latin];Benzoestrolum;Chemestrogen;Octoestrolum;UNII-A27512LR47;4,4'-(1,2-Diethyl-3-methyl-1,3-propanediyl)bisphenol;Phenol, 4,4'-(1,2-diethyl-3-methyl-1,3-propanediyl)bis-;4,4'-(3-ethylhexane-2,4-diyl)diphenol |
| आणविक फार्मूला | C20H26O2 |
| आण्विक वजन | 298.4192 |
| InChI | InChI=1/C20H26O2/c1-4-19(14(3)15-6-10-17(21)11-7-15)20(5-2)16-8-12-18(22)13-9-16/h6-14,19-22H,4-5H2,1-3H3 |
| कैस रजिस्टी संख्या | 85-95-0 |
| आणविक संरचना | ![]() |
| घनत्व | 1.063g/cm3 |
| उबलने का समय | 431.4°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.567 |
| फ्लैश प्वाइंट | 192.8°C |
| वाष्प का दबाव | 4.78E-08mmHg at 25°C |
| MSDS | |