ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105-61-3 N-Carbamoylmaleamic acid |
|
| نام محصول | N-Carbamoylmaleamic acid |
| نام انگلیسی | N-Carbamoylmaleamic acid;Maleuric acid;Maleic acid monoureide~Maleuric acid;(2Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid;(2E)-4-(carbamoylamino)-4-oxobut-2-enoic acid;4-(carbamoylamino)-4-oxobut-2-enoate |
| میدان مغناطیسی | C5H5N2O4 |
| وزن مولکولی | 157.1047 |
| InChI | InChI=1/C5H6N2O4/c6-5(11)7-3(8)1-2-4(9)10/h1-2H,(H,9,10)(H3,6,7,8,11)/p-1 |
| شماره سیایاس | 105-61-3 |
| تعداد کمیسیون اروپایی | 203-314-8 |
| ساختار مولکولی | ![]() |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |