ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
174669-73-9 2-Fluoropyridine-3-boronic acid |
|
| نام محصول | 2-Fluoropyridine-3-boronic acid |
| نام انگلیسی | 2-Fluoropyridine-3-boronic acid;2-Fluoro-3-pyridylboronic acid; Boronic acid, B-(2-fluoro-3-pyridinyl)- ;(2-fluoropyridin-3-yl)boronic acid hydrate;(2-fluoropyridin-3-yl)boronic acid;2-FLUORO-3-PYRIDINEBORONIC ACID;2-Fluoropyridin-3-Ylboronic Acid |
| میدان مغناطیسی | C5H5BFNO2 |
| وزن مولکولی | 140.9081 |
| InChI | InChI=1/C5H5BFNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3,9-10H |
| شماره سیایاس | 174669-73-9 |
| ساختار مولکولی | ![]() |
| تراکم | 1.34g/cm3 |
| نقطه غلیان | 322.6°C at 760 mmHg |
| ضریب شکست | 1.507 |
| نقطه اشتعال | 148.9°C |
| فشار بخار | 0.000114mmHg at 25°C |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |