ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216144-91-1 3-(2-Carboxyvinyl)benzeneboronic acid |
|
| نام محصول | 3-(2-Carboxyvinyl)benzeneboronic acid |
| نام انگلیسی | 3-(2-Carboxyvinyl)benzeneboronic acid;3-(2-Carboxyvinyl)phenylboronic acid;3-Boronocinnamic acid;(2E)-3-[3-(dihydroxyboranyl)phenyl]prop-2-enoic acid |
| میدان مغناطیسی | C9H9BO4 |
| وزن مولکولی | 191.9764 |
| InChI | InChI=1/C9H9BO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6,13-14H,(H,11,12)/b5-4+ |
| شماره سیایاس | 216144-91-1 |
| ساختار مولکولی | ![]() |
| تراکم | 1.33g/cm3 |
| نقطه غلیان | 454.1°C at 760 mmHg |
| ضریب شکست | 1.591 |
| نقطه اشتعال | 228.4°C |
| فشار بخار | 4.91E-09mmHg at 25°C |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |