ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-55-7 4،5-dichloro-6-متیل-2- (2-پیریدیل) پیریمیدین؛ 4،5-dichloro-6-متیل-2-پیریدین-2-یلپیریمیدین؛ |
|
نام محصول | 4،5-dichloro-6-متیل-2- (2-پیریدیل) پیریمیدین؛ 4،5-dichloro-6-متیل-2-پیریدین-2-یلپیریمیدین؛ |
نام انگلیسی | 4,5-dichloro-6-methyl-2-(2-pyridyl)pyrimidine;4,5-dichloro-6-methyl-2-pyridin-2-ylpyrimidine |
میدان مغناطیسی | C10H7Cl2N3 |
وزن مولکولی | 240.0887 |
InChI | InChI=1/C10H7Cl2N3/c1-6-8(11)9(12)15-10(14-6)7-4-2-3-5-13-7/h2-5H,1H3 |
شماره سیایاس | 306935-55-7 |
ساختار مولکولی | ![]() |
تراکم | 1.375g/cm3 |
نقطه ذوب | 132℃ |
نقطه غلیان | 270.4°C at 760 mmHg |
ضریب شکست | 1.6 |
نقطه اشتعال | 143.4°C |
فشار بخار | 0.0114mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |