ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
|
| نام محصول | 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
| نام انگلیسی | 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans;2,5-Dihydro-2,5-dimethoxyfuran;2,5-Dimethoxy-2,5-dihydrofuran;(2R,5R)-2,5-dimethoxy-2,5-dihydrofuran;(2R,5S)-2,5-dimethoxy-2,5-dihydrofuran;(2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
| میدان مغناطیسی | C6H10O3 |
| وزن مولکولی | 130.1418 |
| InChI | InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
| شماره سیایاس | 332-77-4 |
| تعداد کمیسیون اروپایی | 206-367-5 |
| ساختار مولکولی | ![]() |
| تراکم | 1.06g/cm3 |
| نقطه غلیان | 161°C at 760 mmHg |
| ضریب شکست | 1.448 |
| نقطه اشتعال | 47.2°C |
| فشار بخار | 3.02mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R10:; |
| توضیحات ایمنی | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S39##Wear eye/face protection.:; |
| MSDS | |