ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3368-21-6 4-Isopropylcinnamic acid |
|
نام محصول | 4-Isopropylcinnamic acid |
نام انگلیسی | 4-Isopropylcinnamic acid;p-Isopropylcinnamic acid;AI3-23710;Cinnamic acid, p-isopropyl-;NSC 216;2-Propenoic acid, 3-(4-(1-methylethyl)phenyl)-;(2E)-3-[4-(1-methylethyl)phenyl]prop-2-enoate |
میدان مغناطیسی | C12H13O2 |
وزن مولکولی | 189.231 |
InChI | InChI=1/C12H14O2/c1-9(2)11-6-3-10(4-7-11)5-8-12(13)14/h3-9H,1-2H3,(H,13,14)/p-1/b8-5+ |
شماره سیایاس | 3368-21-6 |
تعداد کمیسیون اروپایی | 222-138-2 |
ساختار مولکولی | ![]() |
نقطه غلیان | 317°C at 760 mmHg |
نقطه اشتعال | 221.5°C |
فشار بخار | 0.000167mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |