ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3662-78-0 4-Methoxycarbonylphenyl isothiocyanate |
|
نام محصول | 4-Methoxycarbonylphenyl isothiocyanate |
نام انگلیسی | 4-Methoxycarbonylphenyl isothiocyanate;Methyl 4-isothiocyanatobenzoate |
میدان مغناطیسی | C9H7NO2S |
وزن مولکولی | 193.2224 |
InChI | InChI=1/C9H7NO2S/c1-12-9(11)7-2-4-8(5-3-7)10-6-13/h2-5H,1H3 |
شماره سیایاس | 3662-78-0 |
ساختار مولکولی | ![]() |
تراکم | 1.16g/cm3 |
نقطه غلیان | 314.3°C at 760 mmHg |
ضریب شکست | 1.566 |
نقطه اشتعال | 143.9°C |
فشار بخار | 0.00047mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |