ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4395-87-3 4-Isopropylphenylacetonitrile |
|
نام محصول | 4-Isopropylphenylacetonitrile |
نام انگلیسی | 4-Isopropylphenylacetonitrile;[4-(propan-2-yl)phenyl]acetonitrile;4-Isopropylphenylaceotnitrile |
میدان مغناطیسی | C11H13N |
وزن مولکولی | 159.2276 |
InChI | InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
شماره سیایاس | 4395-87-3 |
ساختار مولکولی | ![]() |
تراکم | 0.96g/cm3 |
نقطه غلیان | 261.1°C at 760 mmHg |
ضریب شکست | 1.514 |
نقطه اشتعال | 117.5°C |
فشار بخار | 0.0118mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |