ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51942-37-1 4-methoxy-N-[2-(methylsulfanyl)phenyl]benzamide |
|
| نام محصول | 4-methoxy-N-[2-(methylsulfanyl)phenyl]benzamide |
| نام انگلیسی | 4-methoxy-N-[2-(methylsulfanyl)phenyl]benzamide;4-Methoxy-N-[2-(methylsulfanyl)phenyl]benzamide;benzamide, 4-methoxy-N-[2-(methylthio)phenyl]- |
| میدان مغناطیسی | C15H15NO2S |
| وزن مولکولی | 273.3501 |
| InChI | InChI=1/C15H15NO2S/c1-18-12-9-7-11(8-10-12)15(17)16-13-5-3-4-6-14(13)19-2/h3-10H,1-2H3,(H,16,17) |
| شماره سیایاس | 51942-37-1 |
| ساختار مولکولی | ![]() |
| تراکم | 1.22g/cm3 |
| نقطه غلیان | 350.4°C at 760 mmHg |
| ضریب شکست | 1.623 |
| نقطه اشتعال | 165.7°C |
| فشار بخار | 4.41E-05mmHg at 25°C |
| MSDS | |