ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-80-0 Vitamin K1 |
|
| نام محصول | Vitamin K1 |
| نام انگلیسی | Vitamin K1;phytomenadione;2-Methyl-3-phytyl-1,4-naphthoquinone;2-methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl)-1,4-naphthalenedione;Phytonadione;2-methyl-3-[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]naphthalene-1,4-dione;2-methyl-3-(3,7,11,15-tetramethylhexadecyl)decalin-1,4-diolate;2-methyl-3-[(7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione |
| میدان مغناطیسی | C31H46O2 |
| وزن مولکولی | 450.6957 |
| InChI | InChI=1/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3/t23-,24-/m1/s1 |
| شماره سیایاس | 84-80-0;11104-38-4 |
| تعداد کمیسیون اروپایی | 234-330-3 |
| ساختار مولکولی | ![]() |
| تراکم | 0.963g/cm3 |
| نقطه غلیان | 546.4°C at 760 mmHg |
| ضریب شکست | 1.51 |
| نقطه اشتعال | 200.4°C |
| فشار بخار | 5.37E-12mmHg at 25°C |
| MSDS | |