ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-39-5 2-Chlorothioxanthen-9-one |
|
| نام محصول | 2-Chlorothioxanthen-9-one |
| نام انگلیسی | 2-Chlorothioxanthen-9-one;2-Chlorothoxanthone;2-Chlorothioxanthene-9-one;2-chloro-9h-thioxanthen-9-on;2-chloro-9H-Thioxanthen-9-one;KayacureCTX;NissoCureCTX;QuantacureCTX;Sandoray1050;Thioxanthen-9-one,2-chloro-;UCI100;2-Chlorothioxanthone;Photoinitiator-CTX; |
| میدان مغناطیسی | C13H7ClOS |
| وزن مولکولی | 246.7121 |
| InChI | InChI=1/C13H7ClOS/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7H |
| شماره سیایاس | 86-39-5 |
| تعداد کمیسیون اروپایی | 201-667-2 |
| ساختار مولکولی | ![]() |
| تراکم | 1.417g/cm3 |
| نقطه ذوب | 152-154℃ |
| نقطه غلیان | 409.4°C at 760 mmHg |
| ضریب شکست | 1.696 |
| نقطه اشتعال | 201.4°C |
| فشار بخار | 6.5E-07mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R11:; |
| توضیحات ایمنی | S16||S33:; |
| MSDS | |