ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-13-4 2-اتیل هاگزیل 8-متیلنونیل فتالات؛ 1.2-Benzenedicarboxylic acid، 1- (2-ethylhexyl) 2- (8-methylnonyl) استر؛ 2-اتیل هاگزیل 8-متیلنونیل فتالات؛ 1.2-Benzenedicarboxylic acid، 2-ethylhexyl 8-methylnonyl ester؛ 2-متیل هپتیل 8-متیلنونیل بنزن-1.2-دی کربوکسیلات؛ |
|
| نام محصول | 2-اتیل هاگزیل 8-متیلنونیل فتالات؛ 1.2-Benzenedicarboxylic acid، 1- (2-ethylhexyl) 2- (8-methylnonyl) استر؛ 2-اتیل هاگزیل 8-متیلنونیل فتالات؛ 1.2-Benzenedicarboxylic acid، 2-ethylhexyl 8-methylnonyl ester؛ 2-متیل هپتیل 8-متیلنونیل بنزن-1.2-دی کربوکسیلات؛ |
| نام انگلیسی | 2-ethylhexyl 8-methylnonyl phthalate;1,2-Benzenedicarboxylic acid, 1-(2-ethylhexyl) 2-(8-methylnonyl) ester;2-Ethylhexyl 8-methylnonyl phthalate;1,2-Benzenedicarboxylic acid, 2-ethylhexyl 8-methylnonyl ester;2-methylheptyl 8-methylnonyl benzene-1,2-dicarboxylate |
| میدان مغناطیسی | C26H42O4 |
| وزن مولکولی | 418.6093 |
| InChI | InChI=1/C26H42O4/c1-5-6-10-16-22(4)20-30-26(28)24-18-13-12-17-23(24)25(27)29-19-14-9-7-8-11-15-21(2)3/h12-13,17-18,21-22H,5-11,14-16,19-20H2,1-4H3 |
| شماره سیایاس | 89-13-4 |
| تعداد کمیسیون اروپایی | 201-883-7 |
| ساختار مولکولی | ![]() |
| تراکم | 0.973g/cm3 |
| نقطه غلیان | 405.7°C at 760 mmHg |
| ضریب شکست | 1.487 |
| نقطه اشتعال | 216.3°C |
| فشار بخار | 8.61E-07mmHg at 25°C |
| MSDS | |