ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102561-42-2 isocianato di 3-fluoro-4-metilfenile |
|
| Nome del prodotto | isocianato di 3-fluoro-4-metilfenile |
| Sinonimi | 2-fluoro-4-isotiocianato-1-metilbenzene; 2-fluoro-4-isocianato-1-metilbenzene; 1-fluoro-4-isocianato-2-metilbenzene; |
| Nome inglese | 3-fluoro-4-methylphenyl isocyanate;2-fluoro-4-isothiocyanato-1-methylbenzene;2-fluoro-4-isocyanato-1-methylbenzene;1-fluoro-4-isocyanato-2-methylbenzene |
| Formula molecolare | C8H6FNO |
| Peso Molecolare | 151.1377 |
| InChI | InChI=1/C8H6FNO/c1-6-4-7(10-5-11)2-3-8(6)9/h2-4H,1H3 |
| Numero CAS | 102561-42-2 |
| Struttura molecolare | ![]() |
| Densità | 1.1g/cm3 |
| Punto di ebollizione | 208.6°C at 760 mmHg |
| Indice di rifrazione | 1.503 |
| Punto d'infiammabilità | 76.1°C |
| Pressione di vapore | 0.212mmHg at 25°C |
| MSDS | |