ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103724-37-4 3-methoxy-N,N'-diaminophthalamide |
|
| Nome del prodotto | 3-methoxy-N,N'-diaminophthalamide |
| Nome inglese | 3-methoxy-N,N'-diaminophthalamide;3-Methoxy-N,N'-diaminophthalamide;3-Methoxy-1,2-benzenedicarboxylic acid dihydrazide;1,2-Benzenedicarboxylic acid, 3-methoxy-, dihydrazide;3-methoxybenzene-1,2-dicarbohydrazide |
| Formula molecolare | C9H12N4O3 |
| Peso Molecolare | 224.2166 |
| InChI | InChI=1/C9H12N4O3/c1-16-6-4-2-3-5(8(14)12-10)7(6)9(15)13-11/h2-4H,10-11H2,1H3,(H,12,14)(H,13,15) |
| Numero CAS | 103724-37-4 |
| Struttura molecolare | ![]() |
| Densità | 1.33g/cm3 |
| Indice di rifrazione | 1.604 |
| MSDS | |