ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-75-6 2-ethyl-hexylamine |
|
| Nome del prodotto | 2-ethyl-hexylamine |
| Nome inglese | 2-ethyl-hexylamine;Isooctyl amine;1-Hexanamine, 2-ethyl-;2-ethylhexylamine;TIMTEC-BB SBB006745;1-Amino-2-ethylhexan;2-ethvlhexvlamine;2-ethyl-1-hexanamin;2-Ethylhexanamine;2-ethyl-hexylamin;3-Octylamine;Armeen L8D;2-ethylhexan-1-amine;octan-1-amine;(2R)-2-ethylhexan-1-aminium;(2R)-2-ethylhexan-1-amine;(2S)-2-ethylhexan-1-aminium |
| Formula molecolare | C8H20N |
| Peso Molecolare | 130.2506 |
| InChI | InChI=1/C8H19N/c1-3-5-6-8(4-2)7-9/h8H,3-7,9H2,1-2H3/p+1/t8-/m0/s1 |
| Numero CAS | 104-75-6 |
| EINECS | 203-233-8 |
| Struttura molecolare | ![]() |
| Punto di fusione | -76℃ |
| Punto di ebollizione | 167.3°C at 760 mmHg |
| Punto d'infiammabilità | 52.2°C |
| Solubilità in acqua | 2.5 g/L (20℃) |
| Pressione di vapore | 1.71mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R10||R21/22||R23||R34:; |
| Sicurezza Descrizione | S16||S26||S36/37/39||S45:; |
| MSDS | |