ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105-05-5 1,4-Diethylbenzene |
|
| Nome del prodotto | 1,4-Diethylbenzene |
| Nome inglese | 1,4-Diethylbenzene;Benzene, 1,4-diethyl-;Benzene, p-diethyl-;HSDB 4083;p-Diethylbenzene;p-Ethylethylbenzene;butan-2-ylbenzene;PDEB |
| Formula molecolare | C10H14 |
| Peso Molecolare | 134.2182 |
| InChI | InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| Numero CAS | 105-05-5 |
| EINECS | 203-265-2 |
| Struttura molecolare | ![]() |
| Densità | 0.86g/cm3 |
| Punto di fusione | -43℃ |
| Punto di ebollizione | 173.3°C at 760 mmHg |
| Indice di rifrazione | 1.489 |
| Punto d'infiammabilità | 46.3°C |
| Pressione di vapore | 1.7mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |