ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105-54-4 Ethyl butyrate |
|
| Nome del prodotto | Ethyl butyrate |
| Nome inglese | Ethyl butyrate;Butyric acid ethyl ester;Ethylbutyrat;Ethyl butanoate;ETHYL BUTYRATE;ethyl butanoate;ethyl ester;butyric acid |
| Formula molecolare | C6H12O2 |
| Peso Molecolare | 116.1583 |
| InChI | InChI=1/C6H12O2/c1-3-5-6(7)8-4-2/h3-5H2,1-2H3 |
| Numero CAS | 105-54-4 |
| EINECS | 203-306-4 |
| Struttura molecolare | ![]() |
| Densità | 0.886g/cm3 |
| Punto di fusione | -93.3℃ |
| Punto di ebollizione | 122.4°C at 760 mmHg |
| Indice di rifrazione | 1.397 |
| Punto d'infiammabilità | 19.4°C |
| Solubilità in acqua | practically insoluble |
| Pressione di vapore | 13.9mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R10||R36/37/38:; |
| Sicurezza Descrizione | S16||S26||S36:; |
| MSDS | |