ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105234-92-2 acido 3-metil-4-nitrofenil beta-D-glucopyranosiduronico |
|
| Nome del prodotto | acido 3-metil-4-nitrofenil beta-D-glucopyranosiduronico |
| Nome inglese | 3-methyl-4-nitrophenyl beta-D-glucopyranosiduronic acid; |
| Formula molecolare | C13H15NO9 |
| Peso Molecolare | 329.2595 |
| InChI | InChI=1/C13H15NO9/c1-5-4-6(2-3-7(5)14(20)21)22-13-10(17)8(15)9(16)11(23-13)12(18)19/h2-4,8-11,13,15-17H,1H3,(H,18,19)/t8-,9-,10+,11-,13+/m0/s1 |
| Numero CAS | 105234-92-2 |
| Struttura molecolare | ![]() |
| Densità | 1.66g/cm3 |
| Punto di ebollizione | 642.1°C at 760 mmHg |
| Indice di rifrazione | 1.66 |
| Punto d'infiammabilità | 342.1°C |
| Pressione di vapore | 2.29E-17mmHg at 25°C |
| MSDS | |