ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107-85-7 Isoamylamine |
|
| Nome del prodotto | Isoamylamine |
| Nome inglese | Isoamylamine;3-Methyl-1-butanamine;Isopentylamine;3-Methylbutylamine;1-amino-3-methylbutane;3-methylbutan-1-amine;3-methylbutan-1-amine hydrochloride (1:1);3-methylbutan-1-aminium |
| Formula molecolare | C5H14N |
| Peso Molecolare | 88.1708 |
| InChI | InChI=1/C5H13N/c1-5(2)3-4-6/h5H,3-4,6H2,1-2H3/p+1 |
| Numero CAS | 107-85-7 |
| EINECS | 203-526-0 |
| Struttura molecolare | ![]() |
| Punto di fusione | -60℃ |
| Punto di ebollizione | 92.7°C at 760 mmHg |
| Punto d'infiammabilità | 18.3°C |
| Pressione di vapore | 51.1mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R11##Highly flammable.||R34##Causes burns.:; |
| Sicurezza Descrizione | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |