ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
116400-63-6 3-idrossi-1,2,4-trimetossi-9H-xanteno-9-one |
|
| Nome del prodotto | 3-idrossi-1,2,4-trimetossi-9H-xanteno-9-one |
| Nome inglese | 3-hydroxy-1,2,4-trimethoxy-9H-xanthen-9-one; |
| Formula molecolare | C16H14O6 |
| Peso Molecolare | 302.2788 |
| InChI | InChI=1/C16H14O6/c1-19-13-10-11(17)8-6-4-5-7-9(8)22-14(10)16(21-3)12(18)15(13)20-2/h4-7,18H,1-3H3 |
| Numero CAS | 116400-63-6 |
| Struttura molecolare | ![]() |
| Densità | 1.349g/cm3 |
| Punto di ebollizione | 513.5°C at 760 mmHg |
| Indice di rifrazione | 1.607 |
| Punto d'infiammabilità | 193.6°C |
| Pressione di vapore | 3.62E-11mmHg at 25°C |
| MSDS | |