ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
117695-55-3 3,5-Dibromobenzeneboronic acid |
|
| Nome del prodotto | 3,5-Dibromobenzeneboronic acid |
| Nome inglese | 3,5-Dibromobenzeneboronic acid;3,5-Dibromophenylboronic acid;3,5-dibrombenzolboronsaeure;3,5-Dibromophenyl boronic acid |
| Formula molecolare | C6H5BBr2O2 |
| Peso Molecolare | 279.7217 |
| InChI | InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| Numero CAS | 117695-55-3 |
| Struttura molecolare | ![]() |
| Densità | 2.09g/cm3 |
| Punto di fusione | 300℃ |
| Punto di ebollizione | 382.8°C at 760 mmHg |
| Indice di rifrazione | 1.651 |
| Punto d'infiammabilità | 185.3°C |
| Pressione di vapore | 1.52E-06mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |