ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206559-57-1 2,5-difluorophenyl isothiocyanate |
|
| Nome del prodotto | 2,5-difluorophenyl isothiocyanate |
| Nome inglese | 2,5-difluorophenyl isothiocyanate;1,4-difluoro-2-isocyanatobenzene |
| Formula molecolare | C7H3F2NO |
| Peso Molecolare | 155.1016 |
| InChI | InChI=1/C7H3F2NO/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| Numero CAS | 206559-57-1 |
| Struttura molecolare | ![]() |
| Densità | 1.24g/cm3 |
| Punto di ebollizione | 181.1°C at 760 mmHg |
| Indice di rifrazione | 1.488 |
| Punto d'infiammabilità | 56.1°C |
| Pressione di vapore | 0.867mmHg at 25°C |
| Codici di Rischio | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |