ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21602-46-0 1-metil-4-[1-(prop-2-en-1-il)cicloesil]piperazina |
|
| Nome del prodotto | 1-metil-4-[1-(prop-2-en-1-il)cicloesil]piperazina |
| Nome inglese | 1-methyl-4-[1-(prop-2-en-1-yl)cyclohexyl]piperazine; |
| Formula molecolare | C14H26N2 |
| Peso Molecolare | 222.3696 |
| InChI | InChI=1/C14H26N2/c1-3-7-14(8-5-4-6-9-14)16-12-10-15(2)11-13-16/h3H,1,4-13H2,2H3 |
| Numero CAS | 21602-46-0 |
| Struttura molecolare | ![]() |
| Densità | 0.941g/cm3 |
| Punto di ebollizione | 295.2°C at 760 mmHg |
| Indice di rifrazione | 1.5 |
| Punto d'infiammabilità | 121.5°C |
| Pressione di vapore | 0.00155mmHg at 25°C |
| MSDS | |