ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22272-24-8 2-chloro-3-[(2-methoxypropyl)amino]naphthalene-1,4-dione |
|
| Nome del prodotto | 2-chloro-3-[(2-methoxypropyl)amino]naphthalene-1,4-dione |
| Nome inglese | 2-chloro-3-[(2-methoxypropyl)amino]naphthalene-1,4-dione; |
| Formula molecolare | C14H14ClNO3 |
| Peso Molecolare | 279.7189 |
| InChI | InChI=1/C14H14ClNO3/c1-8(19-2)7-16-12-11(15)13(17)9-5-3-4-6-10(9)14(12)18/h3-6,8,16H,7H2,1-2H3 |
| Numero CAS | 22272-24-8 |
| Struttura molecolare | ![]() |
| Densità | 1.29g/cm3 |
| Punto di ebollizione | 380.3°C at 760 mmHg |
| Indice di rifrazione | 1.579 |
| Punto d'infiammabilità | 183.8°C |
| Pressione di vapore | 5.5E-06mmHg at 25°C |
| MSDS | |