ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
324763-39-5 4-[(2R)-2-(Chloromethyl)-3-methylbutyl]-1-methoxy-2-(3-methoxypropoxy)benzene |
|
| Nome del prodotto | 4-[(2R)-2-(Chloromethyl)-3-methylbutyl]-1-methoxy-2-(3-methoxypropoxy)benzene |
| Nome inglese | 4-[(2R)-2-(Chloromethyl)-3-methylbutyl]-1-methoxy-2-(3-methoxypropoxy)benzene;Aliskiren inter-1;4-[(2R)-2-(chloromethyl)-3-methylbutyl]-1-methoxy-2-(3-methoxypropoxy)-benzene;Benzene, 4-[(2R)-2-(chloromethyl)-3-methylbutyl]-1-methoxy-2-(3-methoxypropoxy)-;2-(3-methoxypropoxy)-4-((R)-2-(chloromethyl)-3-methylbutyl)-1-methoxybenzene |
| Formula molecolare | C17H27ClO3 |
| Peso Molecolare | 314.8475 |
| InChI | InChI=1/C17H27ClO3/c1-13(2)15(12-18)10-14-6-7-16(20-4)17(11-14)21-9-5-8-19-3/h6-7,11,13,15H,5,8-10,12H2,1-4H3/t15-/m0/s1 |
| Numero CAS | 324763-39-5 |
| Struttura molecolare | ![]() |
| Densità | 1.035g/cm3 |
| Punto di ebollizione | 398.462°C at 760 mmHg |
| Indice di rifrazione | 1.491 |
| Punto d'infiammabilità | 122.153°C |
| Pressione di vapore | 0mmHg at 25°C |
| MSDS | |