ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32793-87-6 (-)-[(2-metilbutossi)metil]benzene |
|
| Nome del prodotto | (-)-[(2-metilbutossi)metil]benzene |
| Sinonimi | (-)-((2-metilbutossi)metil)benzene |
| Nome inglese | (-)-[(2-methylbutoxy)methyl]benzene;(-)-((2-Methylbutoxy)methyl)benzene |
| Formula molecolare | C12H18O |
| Peso Molecolare | 178.273 |
| InChI | InChI=1/C12H18O/c1-3-11(2)9-13-10-12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3 |
| Numero CAS | 32793-87-6 |
| EINECS | 251-221-6 |
| Struttura molecolare | ![]() |
| MSDS | |