ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-51-4 (4-fluorophenylthio)acetic acid |
|
| Nome del prodotto | (4-fluorophenylthio)acetic acid |
| Nome inglese | (4-fluorophenylthio)acetic acid;2-[(4-Fluorophenyl)thio]acetic acid;[(4-fluorophenyl)sulfanyl]acetic acid;[(4-fluorophenyl)sulfanyl]acetate;2-(4-Fluorophenylthio)acetic acid |
| Formula molecolare | C8H6FO2S |
| Peso Molecolare | 185.196 |
| InChI | InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| Numero CAS | 332-51-4 |
| Struttura molecolare | ![]() |
| Punto di fusione | 76-79℃ |
| Punto di ebollizione | 315.4°C at 760 mmHg |
| Punto d'infiammabilità | 144.5°C |
| Pressione di vapore | 0.000185mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |