ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
397843-67-3 4-(N-Isopropylaminocarbonyl)phenylboronic acid |
|
| Nome del prodotto | 4-(N-Isopropylaminocarbonyl)phenylboronic acid |
| Nome inglese | 4-(N-Isopropylaminocarbonyl)phenylboronic acid;[4-(Isopropylcarbamoyl)phenyl]boronic acid;boronic acid, B-[4-[[(1-methylethyl)amino]carbonyl]phenyl]-;{4-[(1-methylethyl)carbamoyl]phenyl}boronic acid |
| Formula molecolare | C10H14BNO3 |
| Peso Molecolare | 207.0341 |
| InChI | InChI=1/C10H14BNO3/c1-7(2)12-10(13)8-3-5-9(6-4-8)11(14)15/h3-7,14-15H,1-2H3,(H,12,13) |
| Numero CAS | 397843-67-3 |
| Struttura molecolare | ![]() |
| Densità | 1.16g/cm3 |
| Indice di rifrazione | 1.536 |
| MSDS | |