ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4160-52-5 p-Methylbutyrophenone |
|
Nome del prodotto | p-Methylbutyrophenone |
Nome inglese | p-Methylbutyrophenone;4-Methylbutyrophenone;4-Butyryltoluene;1-(4-methylphenyl)butan-1-one;4-bromo-5-{2-[(2,4-dichlorophenyl)methylidene]hydrazino}pyridazin-3(2H)-one;1-(p-Tolyl)butan-1-one |
Formula molecolare | C11H7BrCl2N4O |
Peso Molecolare | 362.0095 |
InChI | InChI=1/C11H7BrCl2N4O/c12-10-9(5-16-18-11(10)19)17-15-4-6-1-2-7(13)3-8(6)14/h1-5H,(H2,17,18,19) |
Numero CAS | 4160-52-5 |
EINECS | 223-996-0 |
Struttura molecolare | ![]() |
Densità | 1.8g/cm3 |
Indice di rifrazione | 1.707 |
Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
MSDS |