ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4424-17-3 2-Aminobenzanilide |
|
| Nome del prodotto | 2-Aminobenzanilide |
| Nome inglese | 2-Aminobenzanilide;2-Amino-N-phenylbenzamide~Phenylanthranilamide;2-amino-N-phenylbenzamide;N-(2-aminophenyl)benzamide |
| Formula molecolare | C13H12N2O |
| Peso Molecolare | 212.2472 |
| InChI | InChI=1/C13H12N2O/c14-11-8-4-5-9-12(11)15-13(16)10-6-2-1-3-7-10/h1-9H,14H2,(H,15,16) |
| Numero CAS | 4424-17-3 |
| EINECS | 224-599-5 |
| Struttura molecolare | ![]() |
| Densità | 1.244g/cm3 |
| Punto di ebollizione | 293.2°C at 760 mmHg |
| Indice di rifrazione | 1.688 |
| Punto d'infiammabilità | 131.1°C |
| Pressione di vapore | 0.00175mmHg at 25°C |
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |