ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-37-8 3-fluorobenzamide |
|
| Nome del prodotto | 3-fluorobenzamide |
| Nome inglese | 3-fluorobenzamide;m-Fluorobenzamide |
| Formula molecolare | C7H6FNO |
| Peso Molecolare | 139.127 |
| InChI | InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
| Numero CAS | 455-37-8 |
| EINECS | 207-247-5 |
| Struttura molecolare | ![]() |
| Densità | 1.238g/cm3 |
| Punto di fusione | 129-132℃ |
| Punto di ebollizione | 238.4°C at 760 mmHg |
| Indice di rifrazione | 1.538 |
| Punto d'infiammabilità | 98°C |
| Pressione di vapore | 0.0426mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |