ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
480-93-3 1H-indol-3-ol |
|
Nome del prodotto | 1H-indol-3-ol |
Nome inglese | 1H-indol-3-ol;3-Hydroxyindole;1-Boc-1H-Indol-3-ol |
Formula molecolare | C8H7NO |
Peso Molecolare | 133.15 |
InChI | InChI=1/C8H7NO/c10-8-5-9-7-4-2-1-3-6(7)8/h1-5,9-10H |
Numero CAS | 480-93-3 |
Struttura molecolare | ![]() |
Simboli di pericolo | |
Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |