ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50-27-1 Estriol |
|
| Nome del prodotto | Estriol |
| Nome inglese | Estriol;oestriol;1,3,5(10)-Estratriene-3,16a,17b-triol; Estra-1,3,5(10)-triene-3,16alpha,17beta-triol;(16alpha,17beta)-estra-1,3,5(10)-triene-3,16,17-triol;(8R,13S,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
| Formula molecolare | C18H24O3 |
| Peso Molecolare | 288.3814 |
| InChI | InChI=1/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13?,14-,15?,16?,17+,18+/m1/s1 |
| Numero CAS | 50-27-1 |
| EINECS | 200-022-2 |
| Struttura molecolare | ![]() |
| Densità | 1.255g/cm3 |
| Punto di fusione | 281-282℃ |
| Punto di ebollizione | 469°C at 760 mmHg |
| Indice di rifrazione | 1.624 |
| Punto d'infiammabilità | 220.8°C |
| Pressione di vapore | 1.34E-09mmHg at 25°C |
| MSDS | |