ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
502-85-2 4-Hydroxybutyric acid, sodium salt |
|
| Nome del prodotto | 4-Hydroxybutyric acid, sodium salt |
| Nome inglese | 4-Hydroxybutyric acid, sodium salt;Sodium Oxybate;4-Hydroxybutyric acid sodium salt;Sodium 4-hydroxybutyrate;Gamma-Hydroxybutyrate Sodium Salt;sodium 4-hydroxybutanoate |
| Formula molecolare | C4H7NaO3 |
| Peso Molecolare | 126.0863 |
| InChI | InChI=1/C4H8O3.Na/c5-3-1-2-4(6)7;/h5H,1-3H2,(H,6,7);/q;+1/p-1 |
| Numero CAS | 502-85-2 |
| EINECS | 207-953-3 |
| Struttura molecolare | ![]() |
| Punto di fusione | 143-147℃ |
| Punto di ebollizione | 295.6°C at 760 mmHg |
| Punto d'infiammabilità | 146.8°C |
| Pressione di vapore | 0.000156mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |