ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
504-20-1 phorone |
|
| Nome del prodotto | phorone |
| Nome inglese | phorone;2,6-Dimethyl-2,5-heptadien-4-one;Diisopropyllideneacetone;2,6-dimethylhepta-2,5-dien-4-one |
| Formula molecolare | C9H14O |
| Peso Molecolare | 138.2069 |
| InChI | InChI=1/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3 |
| Numero CAS | 504-20-1 |
| EINECS | 207-986-3 |
| Struttura molecolare | ![]() |
| Densità | 0.858g/cm3 |
| Punto di fusione | 23-26℃ |
| Punto di ebollizione | 198.5°C at 760 mmHg |
| Indice di rifrazione | 1.453 |
| Punto d'infiammabilità | 79.4°C |
| Pressione di vapore | 0.358mmHg at 25°C |
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |