ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50677-27-5 4-chloro-N'-(chloroacetyl)benzohydrazide |
|
| Nome del prodotto | 4-chloro-N'-(chloroacetyl)benzohydrazide |
| Nome inglese | 4-chloro-N'-(chloroacetyl)benzohydrazide;4-Chloro-N'-(chloroacetyl)benzohydrazide;benzoic acid, 4-chloro-, 2-(2-chloroacetyl)hydrazide |
| Formula molecolare | C9H8Cl2N2O2 |
| Peso Molecolare | 247.078 |
| InChI | InChI=1/C9H8Cl2N2O2/c10-5-8(14)12-13-9(15)6-1-3-7(11)4-2-6/h1-4H,5H2,(H,12,14)(H,13,15) |
| Numero CAS | 50677-27-5 |
| Struttura molecolare | ![]() |
| Densità | 1.407g/cm3 |
| Punto di ebollizione | 489.7°C at 760 mmHg |
| Indice di rifrazione | 1.573 |
| Punto d'infiammabilità | 249.9°C |
| Pressione di vapore | 9.77E-10mmHg at 25°C |
| MSDS | |